C11H22N2O3S — CID 55014026
(3aR,7aS)-2-(2-methoxyethylsulfonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 55014026) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is (3aR,7aS)-2-(2-methoxyethylsulfonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aR,7aS)-2-(2-methoxyethylsulfonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 55014026 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (3aR,7aS)-2-(2-methoxyethylsulfonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | COCCS(=O)(=O)N1C[C@H]2CCC(N)C[C@H]2C1 |
| InChI | InChI=1S/C11H22N2O3S/c1-16-4-5-17(14,15)13-7-9-2-3-11(12)6-10(9)8-13/h9-11H,2-8,12H2,1H3/t9-,10+,11?/m1/s1 |
| InChIKey | BEDLPRNTMHFMCW-JKIOLJMWSA-N |
| XLogP | 0.02 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |