C12H24N2O3S2 — CID 55014118
1-(2-methoxyethylsulfonylamino)cyclooctane-1-carbothioamide (PubChem CID 55014118) has the molecular formula C12H24N2O3S2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-(2-methoxyethylsulfonylamino)cyclooctane-1-carbothioamide.
| Compound Name | 1-(2-methoxyethylsulfonylamino)cyclooctane-1-carbothioamide |
|---|---|
| PubChem CID | 55014118 |
| Molecular Formula | C12H24N2O3S2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-(2-methoxyethylsulfonylamino)cyclooctane-1-carbothioamide |
| SMILES | COCCS(=O)(=O)NC1(C(N)=S)CCCCCCC1 |
| InChI | InChI=1S/C12H24N2O3S2/c1-17-9-10-19(15,16)14-12(11(13)18)7-5-3-2-4-6-8-12/h14H,2-10H2,1H3,(H2,13,18) |
| InChIKey | BRBBODUJADPWIZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|