C15H23NO — CID 55014332
N-[(3,4-dimethylphenyl)methyl]-1-(oxan-2-yl)methanamine (PubChem CID 55014332) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)methyl]-1-(oxan-2-yl)methanamine.
| Compound Name | N-[(3,4-dimethylphenyl)methyl]-1-(oxan-2-yl)methanamine |
|---|---|
| PubChem CID | 55014332 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-[(3,4-dimethylphenyl)methyl]-1-(oxan-2-yl)methanamine |
| SMILES | Cc1ccc(CNCC2CCCCO2)cc1C |
| InChI | InChI=1S/C15H23NO/c1-12-6-7-14(9-13(12)2)10-16-11-15-5-3-4-8-17-15/h6-7,9,15-16H,3-5,8,10-11H2,1-2H3 |
| InChIKey | JJPONYGOOUDWET-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |