About 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine
1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine (PubChem CID 55015046) has the molecular formula C15H23ClN2O
and a molecular weight of 282.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine |
| PubChem CID | 55015046 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine |
| SMILES | CC(N)C(c1ccc(Cl)cc1)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C15H23ClN2O/c1-11(17)14(12-4-6-13(16)7-5-12)18-8-9-19-15(2,3)10-18/h4-7,11,14H,8-10,17H2,1-3H3 |
| InChIKey | HFYUPEGGDHFKFS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine?
The IUPAC name of 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine (CID 55015046) is 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine.
What is the SMILES notation for 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine?
The canonical SMILES for 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine is CC(N)C(c1ccc(Cl)cc1)N1CCOC(C)(C)C1.
What is the InChIKey of 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine?
The InChIKey is HFYUPEGGDHFKFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23ClN2O/c1-11(17)14(12-4-6-13(16)7-5-12)18-8-9-19-15(2,3)10-18/h4-7,11,14H,8-10,17H2,1-3H3.
What are the key properties of 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine?
1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine has a molecular weight of 282.81 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine is sourced from PubChem (CID 55015046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).