C15H22BrN3 — CID 55015549
3-[[2-amino-1-(4-bromophenyl)butyl]-ethylamino]propanenitrile (PubChem CID 55015549) has the molecular formula C15H22BrN3 and a molecular weight of 324.27 g/mol. Its IUPAC name is 3-[[2-amino-1-(4-bromophenyl)butyl]-ethylamino]propanenitrile.
| Compound Name | 3-[[2-amino-1-(4-bromophenyl)butyl]-ethylamino]propanenitrile |
|---|---|
| PubChem CID | 55015549 |
| Molecular Formula | C15H22BrN3 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 3-[[2-amino-1-(4-bromophenyl)butyl]-ethylamino]propanenitrile |
| SMILES | CCC(N)C(c1ccc(Br)cc1)N(CC)CCC#N |
| InChI | InChI=1S/C15H22BrN3/c1-3-14(18)15(19(4-2)11-5-10-17)12-6-8-13(16)9-7-12/h6-9,14-15H,3-5,11,18H2,1-2H3 |
| InChIKey | NYPUYUSJTVOXFA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |