C11H15N5S — CID 55016371
2-(4-methylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylethanamine (PubChem CID 55016371) has the molecular formula C11H15N5S and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-(4-methylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | 2-(4-methylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 55016371 |
| Molecular Formula | C11H15N5S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-(4-methylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
| SMILES | Cc1ccc(C(CN)Sc2nnnn2C)cc1 |
| InChI | InChI=1S/C11H15N5S/c1-8-3-5-9(6-4-8)10(7-12)17-11-13-14-15-16(11)2/h3-6,10H,7,12H2,1-2H3 |
| InChIKey | PBTNQMQOMNAEKP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |