C11H13N3OS2 — CID 55017617
5-[2-(3-methylphenoxy)ethylamino]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 55017617) has the molecular formula C11H13N3OS2 and a molecular weight of 267.38 g/mol. Its IUPAC name is 5-[2-(3-methylphenoxy)ethylamino]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[2-(3-methylphenoxy)ethylamino]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 55017617 |
| Molecular Formula | C11H13N3OS2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 5-[2-(3-methylphenoxy)ethylamino]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1cccc(OCCNc2n[nH]c(=S)s2)c1 |
| InChI | InChI=1S/C11H13N3OS2/c1-8-3-2-4-9(7-8)15-6-5-12-10-13-14-11(16)17-10/h2-4,7H,5-6H2,1H3,(H,12,13)(H,14,16) |
| InChIKey | UULNXVZIOXJFSZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|