C11H9F3O2 — CID 550193
4,4,4-trifluoro-1-(4-methylphenyl)butane-1,3-dione (PubChem CID 550193) has the molecular formula C11H9F3O2 and a molecular weight of 230.19 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(4-methylphenyl)butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-1-(4-methylphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 550193 |
| Molecular Formula | C11H9F3O2 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4,4,4-trifluoro-1-(4-methylphenyl)butane-1,3-dione |
| SMILES | Cc1ccc(C(=O)CC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F3O2/c1-7-2-4-8(5-3-7)9(15)6-10(16)11(12,13)14/h2-5H,6H2,1H3 |
| InChIKey | WRZMHTIRFOFFPY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|