C12H23N3OS — CID 55024099
2-[(2-amino-2-sulfanylideneethyl)-methylamino]-N-cycloheptylacetamide (PubChem CID 55024099) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-[(2-amino-2-sulfanylideneethyl)-methylamino]-N-cycloheptylacetamide.
| Compound Name | 2-[(2-amino-2-sulfanylideneethyl)-methylamino]-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 55024099 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-[(2-amino-2-sulfanylideneethyl)-methylamino]-N-cycloheptylacetamide |
| SMILES | CN(CC(=O)NC1CCCCCC1)CC(N)=S |
| InChI | InChI=1S/C12H23N3OS/c1-15(8-11(13)17)9-12(16)14-10-6-4-2-3-5-7-10/h10H,2-9H2,1H3,(H2,13,17)(H,14,16) |
| InChIKey | JBHNZIPOLVKFMM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|