C10H15N3O4S — CID 55024347
2-acetamido-N-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 55024347) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-acetamido-N-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-acetamido-N-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55024347 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-acetamido-N-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)Nc1nc(C(=O)NCCOCCO)cs1 |
| InChI | InChI=1S/C10H15N3O4S/c1-7(15)12-10-13-8(6-18-10)9(16)11-2-4-17-5-3-14/h6,14H,2-5H2,1H3,(H,11,16)(H,12,13,15) |
| InChIKey | ZNHVJMPTFPFVHO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|