C14H31N3 — CID 55024501
2-N,2-N,2-trimethyl-1-N-[2-(1-methylpiperidin-2-yl)ethyl]propane-1,2-diamine (PubChem CID 55024501) has the molecular formula C14H31N3 and a molecular weight of 241.42 g/mol. Its IUPAC name is 2-N,2-N,2-trimethyl-1-N-[2-(1-methylpiperidin-2-yl)ethyl]propane-1,2-diamine.
| Compound Name | 2-N,2-N,2-trimethyl-1-N-[2-(1-methylpiperidin-2-yl)ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 55024501 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | 2-N,2-N,2-trimethyl-1-N-[2-(1-methylpiperidin-2-yl)ethyl]propane-1,2-diamine |
| SMILES | CN1CCCCC1CCNCC(C)(C)N(C)C |
| InChI | InChI=1S/C14H31N3/c1-14(2,16(3)4)12-15-10-9-13-8-6-7-11-17(13)5/h13,15H,6-12H2,1-5H3 |
| InChIKey | PXJDLSCONJYKLF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|