C9H11F7N2O — CID 550259
2,2,3,3,4,4,4-heptafluoro-1-(4-methylpiperazin-1-yl)butan-1-one (PubChem CID 550259) has the molecular formula C9H11F7N2O and a molecular weight of 296.19 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-(4-methylpiperazin-1-yl)butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-(4-methylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 550259 |
| Molecular Formula | C9H11F7N2O |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-(4-methylpiperazin-1-yl)butan-1-one |
| SMILES | CN1CCN(C(=O)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H11F7N2O/c1-17-2-4-18(5-3-17)6(19)7(10,11)8(12,13)9(14,15)16/h2-5H2,1H3 |
| InChIKey | PVOHTVUHQALSJJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|