C16H18FN — CID 55026735
2-(2-fluorophenyl)-N-methyl-1-(2-methylphenyl)ethanamine (PubChem CID 55026735) has the molecular formula C16H18FN and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-methyl-1-(2-methylphenyl)ethanamine.
| Compound Name | 2-(2-fluorophenyl)-N-methyl-1-(2-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 55026735 |
| Molecular Formula | C16H18FN |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-(2-fluorophenyl)-N-methyl-1-(2-methylphenyl)ethanamine |
| SMILES | CNC(Cc1ccccc1F)c1ccccc1C |
| InChI | InChI=1S/C16H18FN/c1-12-7-3-5-9-14(12)16(18-2)11-13-8-4-6-10-15(13)17/h3-10,16,18H,11H2,1-2H3 |
| InChIKey | ZGWNOUQUPBYQPB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |