C10H11N5O2 — CID 55027908
N-methoxy-N-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxamide (PubChem CID 55027908) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is N-methoxy-N-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-methoxy-N-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55027908 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | N-methoxy-N-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxamide |
| SMILES | CON(C)C(=O)c1ccc(-n2cncn2)nc1 |
| InChI | InChI=1S/C10H11N5O2/c1-14(17-2)10(16)8-3-4-9(12-5-8)15-7-11-6-13-15/h3-7H,1-2H3 |
| InChIKey | WEVJKXIZWYRVHE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|