C8H14N4O3 — CID 55027973
2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetohydrazide (PubChem CID 55027973) has the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetohydrazide.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 55027973 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetohydrazide |
| SMILES | CCN1CCN(CC(=O)NN)C(=O)C1=O |
| InChI | InChI=1S/C8H14N4O3/c1-2-11-3-4-12(5-6(13)10-9)8(15)7(11)14/h2-5,9H2,1H3,(H,10,13) |
| InChIKey | NCVVJCQEFQRGIV-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|