About N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide
N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 55028141) has the molecular formula C9H16N4O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide.
Molecular Properties
| Compound Name | N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide |
| PubChem CID | 55028141 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | COCCCNC(=O)C(C)n1cncn1 |
| InChI | InChI=1S/C9H16N4O2/c1-8(13-7-10-6-12-13)9(14)11-4-3-5-15-2/h6-8H,3-5H2,1-2H3,(H,11,14) |
| InChIKey | RXWPFYBZRIHFNB-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide?
The IUPAC name of N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide (CID 55028141) is N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide.
What is the SMILES notation for N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide?
The canonical SMILES for N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide is COCCCNC(=O)C(C)n1cncn1.
What is the InChIKey of N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide?
The InChIKey is RXWPFYBZRIHFNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O2/c1-8(13-7-10-6-12-13)9(14)11-4-3-5-15-2/h6-8H,3-5H2,1-2H3,(H,11,14).
What are the key properties of N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide?
N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide has a molecular weight of 212.25 g/mol, XLogP of -0.01, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxypropyl)-2-(1,2,4-triazol-1-yl)propanamide is sourced from PubChem (CID 55028141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).