C8H9F3N2O2 — CID 55028146
1-ethyl-3-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione (PubChem CID 55028146) has the molecular formula C8H9F3N2O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is 1-ethyl-3-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 1-ethyl-3-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 55028146 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-ethyl-3-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| SMILES | CCn1ccc(=O)n(CC(F)(F)F)c1=O |
| InChI | InChI=1S/C8H9F3N2O2/c1-2-12-4-3-6(14)13(7(12)15)5-8(9,10)11/h3-4H,2,5H2,1H3 |
| InChIKey | UCCJLKWJGBGKRV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |