About methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate
methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate (PubChem CID 55028758) has the molecular formula C11H13N3O4
and a molecular weight of 251.24 g/mol. Its IUPAC name is methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate |
| PubChem CID | 55028758 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate |
| SMILES | COC(=O)CN(C)Cc1noc(-c2ccco2)n1 |
| InChI | InChI=1S/C11H13N3O4/c1-14(7-10(15)16-2)6-9-12-11(18-13-9)8-4-3-5-17-8/h3-5H,6-7H2,1-2H3 |
| InChIKey | KJKHPABENDIWEZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate?
The IUPAC name of methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate (CID 55028758) is methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate.
What is the SMILES notation for methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate?
The canonical SMILES for methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate is COC(=O)CN(C)Cc1noc(-c2ccco2)n1.
What is the InChIKey of methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate?
The InChIKey is KJKHPABENDIWEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O4/c1-14(7-10(15)16-2)6-9-12-11(18-13-9)8-4-3-5-17-8/h3-5H,6-7H2,1-2H3.
What are the key properties of methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate?
methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate has a molecular weight of 251.24 g/mol, XLogP of 0.93, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl-methylamino]acetate is sourced from PubChem (CID 55028758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).