C12H20N2O — CID 55029199
N-(1-cyanocyclopentyl)-3,3-dimethylbutanamide (PubChem CID 55029199) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N-(1-cyanocyclopentyl)-3,3-dimethylbutanamide.
| Compound Name | N-(1-cyanocyclopentyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 55029199 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-(1-cyanocyclopentyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NC1(C#N)CCCC1 |
| InChI | InChI=1S/C12H20N2O/c1-11(2,3)8-10(15)14-12(9-13)6-4-5-7-12/h4-8H2,1-3H3,(H,14,15) |
| InChIKey | KWMCRVCQSYALNE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |