C11H11N3O2S — CID 55029707
N-[(5-methylthiophen-2-yl)methyl]-3-nitropyridin-4-amine (PubChem CID 55029707) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]-3-nitropyridin-4-amine.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]-3-nitropyridin-4-amine |
|---|---|
| PubChem CID | 55029707 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]-3-nitropyridin-4-amine |
| SMILES | Cc1ccc(CNc2ccncc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H11N3O2S/c1-8-2-3-9(17-8)6-13-10-4-5-12-7-11(10)14(15)16/h2-5,7H,6H2,1H3,(H,12,13) |
| InChIKey | LEYZMRHOZOUDIO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|