C10H16N4O3 — CID 55030098
1-[1-(methylamino)-1-oxopropan-2-yl]-5-propyltriazole-4-carboxylic acid (PubChem CID 55030098) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 1-[1-(methylamino)-1-oxopropan-2-yl]-5-propyltriazole-4-carboxylic acid.
| Compound Name | 1-[1-(methylamino)-1-oxopropan-2-yl]-5-propyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 55030098 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-[1-(methylamino)-1-oxopropan-2-yl]-5-propyltriazole-4-carboxylic acid |
| SMILES | CCCc1c(C(=O)O)nnn1C(C)C(=O)NC |
| InChI | InChI=1S/C10H16N4O3/c1-4-5-7-8(10(16)17)12-13-14(7)6(2)9(15)11-3/h6H,4-5H2,1-3H3,(H,11,15)(H,16,17) |
| InChIKey | CPZSAOPNQBNNFL-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |