About cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone
cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone (PubChem CID 55030356) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone |
| PubChem CID | 55030356 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCC(NCC2CCC=CO2)CC1 |
| InChI | InChI=1S/C15H24N2O2/c18-15(12-4-5-12)17-8-6-13(7-9-17)16-11-14-3-1-2-10-19-14/h2,10,12-14,16H,1,3-9,11H2 |
| InChIKey | GGUHLGQPOCYSQG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone?
The IUPAC name of cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone (CID 55030356) is cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone.
What is the SMILES notation for cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone?
The canonical SMILES for cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone is O=C(C1CC1)N1CCC(NCC2CCC=CO2)CC1.
What is the InChIKey of cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone?
The InChIKey is GGUHLGQPOCYSQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2/c18-15(12-4-5-12)17-8-6-13(7-9-17)16-11-14-3-1-2-10-19-14/h2,10,12-14,16H,1,3-9,11H2.
What are the key properties of cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone?
cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone has a molecular weight of 264.37 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]methanone is sourced from PubChem (CID 55030356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).