About 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile
4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile (PubChem CID 55030449) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile |
| PubChem CID | 55030449 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile |
| SMILES | CC(NCC1CCC=CO1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H18N2O/c1-12(14-7-5-13(10-16)6-8-14)17-11-15-4-2-3-9-18-15/h3,5-9,12,15,17H,2,4,11H2,1H3 |
| InChIKey | CSCHRTKXMIEYDK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile?
The IUPAC name of 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile (CID 55030449) is 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile.
What is the SMILES notation for 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile?
The canonical SMILES for 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile is CC(NCC1CCC=CO1)c1ccc(C#N)cc1.
What is the InChIKey of 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile?
The InChIKey is CSCHRTKXMIEYDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O/c1-12(14-7-5-13(10-16)6-8-14)17-11-15-4-2-3-9-18-15/h3,5-9,12,15,17H,2,4,11H2,1H3.
What are the key properties of 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile?
4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile has a molecular weight of 242.32 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]benzonitrile is sourced from PubChem (CID 55030449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).