About 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide
1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide (PubChem CID 55030676) has the molecular formula C10H19N3O4S
and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide |
| PubChem CID | 55030676 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)N(CCO)CCO)nc1C |
| InChI | InChI=1S/C10H19N3O4S/c1-3-12-8-10(11-9(12)2)18(16,17)13(4-6-14)5-7-15/h8,14-15H,3-7H2,1-2H3 |
| InChIKey | ITQVFVGLMLMGAZ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide?
The IUPAC name of 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide (CID 55030676) is 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide.
What is the SMILES notation for 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide?
The canonical SMILES for 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide is CCn1cc(S(=O)(=O)N(CCO)CCO)nc1C.
What is the InChIKey of 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide?
The InChIKey is ITQVFVGLMLMGAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O4S/c1-3-12-8-10(11-9(12)2)18(16,17)13(4-6-14)5-7-15/h8,14-15H,3-7H2,1-2H3.
What are the key properties of 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide?
1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide has a molecular weight of 277.35 g/mol, XLogP of -0.81, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N,N-bis(2-hydroxyethyl)-2-methylimidazole-4-sulfonamide is sourced from PubChem (CID 55030676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).