C10H7BrF3N3O — CID 55030976
4-bromo-2-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 55030976) has the molecular formula C10H7BrF3N3O and a molecular weight of 322.08 g/mol. Its IUPAC name is 4-bromo-2-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 4-bromo-2-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 55030976 |
| Molecular Formula | C10H7BrF3N3O |
| Molecular Weight | 322.08 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | 4-bromo-2-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1ccc(Br)cc1-c1nc(CC(F)(F)F)no1 |
| InChI | InChI=1S/C10H7BrF3N3O/c11-5-1-2-7(15)6(3-5)9-16-8(17-18-9)4-10(12,13)14/h1-3H,4,15H2 |
| InChIKey | WZSARTJARMCDAP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.08 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|