1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid

C10H12N4O2S — CID 55031035

IUPAC1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid
SMILESCCCc1nc(Cn2cc(C(=O)O)nn2)cs1
InChIInChI=1S/C10H12N4O2S/c1-2-3-9-11-7(6-17-9)4-14-5-8(10(15)16)12-13-14/h5-6H,2-4H2,1H3,(H,15,16)
InChIKeyQKSKWGDAZVPTCJ-UHFFFAOYSA-N
MW252.30 g/mol
LogP1.43
Rot. Bonds5

About 1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid

1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid (PubChem CID 55031035) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid.

Molecular Properties

Compound Name1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid
PubChem CID55031035
Molecular FormulaC10H12N4O2S
Molecular Weight252.30 g/mol
Exact Mass252.07
IUPAC Name1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid
SMILESCCCc1nc(Cn2cc(C(=O)O)nn2)cs1
InChIInChI=1S/C10H12N4O2S/c1-2-3-9-11-7(6-17-9)4-14-5-8(10(15)16)12-13-14/h5-6H,2-4H2,1H3,(H,15,16)
InChIKeyQKSKWGDAZVPTCJ-UHFFFAOYSA-N
XLogP1.43
TPSA80.90 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.30
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid?
The IUPAC name of 1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid (CID 55031035) is 1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid.
What is the SMILES notation for 1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid?
The canonical SMILES for 1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid is CCCc1nc(Cn2cc(C(=O)O)nn2)cs1.
What is the InChIKey of 1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid?
The InChIKey is QKSKWGDAZVPTCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O2S/c1-2-3-9-11-7(6-17-9)4-14-5-8(10(15)16)12-13-14/h5-6H,2-4H2,1H3,(H,15,16).
What are the key properties of 1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid?
1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid has a molecular weight of 252.30 g/mol, XLogP of 1.43, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-propyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid is sourced from PubChem (CID 55031035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).