About 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid
5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid (PubChem CID 55031468) has the molecular formula C11H12F3NO3S
and a molecular weight of 295.28 g/mol. Its IUPAC name is 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid |
| PubChem CID | 55031468 |
| Molecular Formula | C11H12F3NO3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid |
| SMILES | CC(C)N(CC(F)(F)F)C(=O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C11H12F3NO3S/c1-6(2)15(5-11(12,13)14)9(16)7-3-4-8(19-7)10(17)18/h3-4,6H,5H2,1-2H3,(H,17,18) |
| InChIKey | ASYCKCKSZREVII-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid (CID 55031468) is 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid is CC(C)N(CC(F)(F)F)C(=O)c1ccc(C(=O)O)s1.
What is the InChIKey of 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid?
The InChIKey is ASYCKCKSZREVII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO3S/c1-6(2)15(5-11(12,13)14)9(16)7-3-4-8(19-7)10(17)18/h3-4,6H,5H2,1-2H3,(H,17,18).
What are the key properties of 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid?
5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid has a molecular weight of 295.28 g/mol, XLogP of 2.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[propan-2-yl(2,2,2-trifluoroethyl)carbamoyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 55031468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).