C11H21F3N2O2 — CID 55031854
N,N-diethyl-2-[2-(2,2,2-trifluoroethoxy)ethylamino]propanamide (PubChem CID 55031854) has the molecular formula C11H21F3N2O2 and a molecular weight of 270.30 g/mol. Its IUPAC name is N,N-diethyl-2-[2-(2,2,2-trifluoroethoxy)ethylamino]propanamide.
| Compound Name | N,N-diethyl-2-[2-(2,2,2-trifluoroethoxy)ethylamino]propanamide |
|---|---|
| PubChem CID | 55031854 |
| Molecular Formula | C11H21F3N2O2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | N,N-diethyl-2-[2-(2,2,2-trifluoroethoxy)ethylamino]propanamide |
| SMILES | CCN(CC)C(=O)C(C)NCCOCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O2/c1-4-16(5-2)10(17)9(3)15-6-7-18-8-11(12,13)14/h9,15H,4-8H2,1-3H3 |
| InChIKey | WKBPJAVLFFRQEB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|