About 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol
1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol (PubChem CID 55032348) has the molecular formula C10H19NO5S2
and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol.
Molecular Properties
| Compound Name | 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol |
| PubChem CID | 55032348 |
| Molecular Formula | C10H19NO5S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N2CCCC(O)C2)CC1 |
| InChI | InChI=1S/C10H19NO5S2/c12-9-2-1-5-11(8-9)18(15,16)10-3-6-17(13,14)7-4-10/h9-10,12H,1-8H2 |
| InChIKey | TUCXPUJVEFNWLT-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol?
The IUPAC name of 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol (CID 55032348) is 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol.
What is the SMILES notation for 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol?
The canonical SMILES for 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol is O=S1(=O)CCC(S(=O)(=O)N2CCCC(O)C2)CC1.
What is the InChIKey of 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol?
The InChIKey is TUCXPUJVEFNWLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO5S2/c12-9-2-1-5-11(8-9)18(15,16)10-3-6-17(13,14)7-4-10/h9-10,12H,1-8H2.
What are the key properties of 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol?
1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol has a molecular weight of 297.40 g/mol, XLogP of -0.65, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol is sourced from PubChem (CID 55032348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).