C15H18N2OS — CID 55032863
N,N-dimethyl-3-(1-thiophen-3-ylethylamino)benzamide (PubChem CID 55032863) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is N,N-dimethyl-3-(1-thiophen-3-ylethylamino)benzamide.
| Compound Name | N,N-dimethyl-3-(1-thiophen-3-ylethylamino)benzamide |
|---|---|
| PubChem CID | 55032863 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N,N-dimethyl-3-(1-thiophen-3-ylethylamino)benzamide |
| SMILES | CC(Nc1cccc(C(=O)N(C)C)c1)c1ccsc1 |
| InChI | InChI=1S/C15H18N2OS/c1-11(13-7-8-19-10-13)16-14-6-4-5-12(9-14)15(18)17(2)3/h4-11,16H,1-3H3 |
| InChIKey | DHFRZGFJKOJBQR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |