C13H18N4S — CID 55032898
2-(1,3,5-trimethylpyrazol-4-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 55032898) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is 2-(1,3,5-trimethylpyrazol-4-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
| Compound Name | 2-(1,3,5-trimethylpyrazol-4-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 55032898 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-(1,3,5-trimethylpyrazol-4-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
| SMILES | Cc1nn(C)c(C)c1-c1nc2c(s1)C(N)CCC2 |
| InChI | InChI=1S/C13H18N4S/c1-7-11(8(2)17(3)16-7)13-15-10-6-4-5-9(14)12(10)18-13/h9H,4-6,14H2,1-3H3 |
| InChIKey | QYJALBSOMWQRBZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |