C12H17F3N2S — CID 55032903
N,5,5-trimethyl-2-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazol-7-amine (PubChem CID 55032903) has the molecular formula C12H17F3N2S and a molecular weight of 278.34 g/mol. Its IUPAC name is N,5,5-trimethyl-2-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazol-7-amine.
| Compound Name | N,5,5-trimethyl-2-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 55032903 |
| Molecular Formula | C12H17F3N2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N,5,5-trimethyl-2-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazol-7-amine |
| SMILES | CNC1CC(C)(C)Cc2nc(CC(F)(F)F)sc21 |
| InChI | InChI=1S/C12H17F3N2S/c1-11(2)4-7(16-3)10-8(5-11)17-9(18-10)6-12(13,14)15/h7,16H,4-6H2,1-3H3 |
| InChIKey | KUPQQGVCYRNUPR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |