C11H14INO4S2 — CID 55033017
N-(2-iodophenyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 55033017) has the molecular formula C11H14INO4S2 and a molecular weight of 415.27 g/mol. Its IUPAC name is N-(2-iodophenyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(2-iodophenyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 55033017 |
| Molecular Formula | C11H14INO4S2 |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 414.94 |
| IUPAC Name | N-(2-iodophenyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)Nc2ccccc2I)CC1 |
| InChI | InChI=1S/C11H14INO4S2/c12-10-3-1-2-4-11(10)13-19(16,17)9-5-7-18(14,15)8-6-9/h1-4,9,13H,5-8H2 |
| InChIKey | MLQZGIKWSNWNRF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|