About 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline
2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline (PubChem CID 55033030) has the molecular formula C12H10Br2ClNO2
and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline.
Molecular Properties
| Compound Name | 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline |
| PubChem CID | 55033030 |
| Molecular Formula | C12H10Br2ClNO2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 392.88 |
| IUPAC Name | 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline |
| SMILES | COc1ccc(Cl)c(NCc2cc(Br)c(Br)o2)c1 |
| InChI | InChI=1S/C12H10Br2ClNO2/c1-17-7-2-3-10(15)11(5-7)16-6-8-4-9(13)12(14)18-8/h2-5,16H,6H2,1H3 |
| InChIKey | OTSYHHAKGNBGLP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline?
The IUPAC name of 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline (CID 55033030) is 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline.
What is the SMILES notation for 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline?
The canonical SMILES for 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline is COc1ccc(Cl)c(NCc2cc(Br)c(Br)o2)c1.
What is the InChIKey of 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline?
The InChIKey is OTSYHHAKGNBGLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Br2ClNO2/c1-17-7-2-3-10(15)11(5-7)16-6-8-4-9(13)12(14)18-8/h2-5,16H,6H2,1H3.
What are the key properties of 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline?
2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline has a molecular weight of 395.48 g/mol, XLogP of 5.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-5-methoxyaniline is sourced from PubChem (CID 55033030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).