C11H17N3O5 — CID 55033395
4-hydroxy-1-[(2-oxopiperidin-3-yl)carbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 55033395) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is 4-hydroxy-1-[(2-oxopiperidin-3-yl)carbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 4-hydroxy-1-[(2-oxopiperidin-3-yl)carbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 55033395 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-hydroxy-1-[(2-oxopiperidin-3-yl)carbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C1NCCCC1NC(=O)N1CC(O)CC1C(=O)O |
| InChI | InChI=1S/C11H17N3O5/c15-6-4-8(10(17)18)14(5-6)11(19)13-7-2-1-3-12-9(7)16/h6-8,15H,1-5H2,(H,12,16)(H,13,19)(H,17,18) |
| InChIKey | OSJFIHIRUGWLEE-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |