C13H16N4O2 — CID 55034313
4-amino-5-cyclopropyl-N-(furan-3-ylmethyl)-N-methyl-1H-pyrazole-3-carboxamide (PubChem CID 55034313) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-amino-5-cyclopropyl-N-(furan-3-ylmethyl)-N-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-5-cyclopropyl-N-(furan-3-ylmethyl)-N-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55034313 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-amino-5-cyclopropyl-N-(furan-3-ylmethyl)-N-methyl-1H-pyrazole-3-carboxamide |
| SMILES | CN(Cc1ccoc1)C(=O)c1n[nH]c(C2CC2)c1N |
| InChI | InChI=1S/C13H16N4O2/c1-17(6-8-4-5-19-7-8)13(18)12-10(14)11(15-16-12)9-2-3-9/h4-5,7,9H,2-3,6,14H2,1H3,(H,15,16) |
| InChIKey | YEHKJQFOTCVSTI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |