About 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid
1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid (PubChem CID 55034793) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid |
| PubChem CID | 55034793 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid |
| SMILES | CC1(C)COCCN1C(=O)C1(C(=O)O)CCC1 |
| InChI | InChI=1S/C12H19NO4/c1-11(2)8-17-7-6-13(11)9(14)12(10(15)16)4-3-5-12/h3-8H2,1-2H3,(H,15,16) |
| InChIKey | KGQGUAVIEHHBMN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid?
The IUPAC name of 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid (CID 55034793) is 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid is CC1(C)COCCN1C(=O)C1(C(=O)O)CCC1.
What is the InChIKey of 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid?
The InChIKey is KGQGUAVIEHHBMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO4/c1-11(2)8-17-7-6-13(11)9(14)12(10(15)16)4-3-5-12/h3-8H2,1-2H3,(H,15,16).
What are the key properties of 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid?
1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid has a molecular weight of 241.29 g/mol, XLogP of 0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylmorpholine-4-carbonyl)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 55034793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).