C11H18N2O4 — CID 55035123
1-[[1-(ethylamino)-1-oxopropan-2-yl]carbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 55035123) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-[[1-(ethylamino)-1-oxopropan-2-yl]carbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[1-(ethylamino)-1-oxopropan-2-yl]carbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 55035123 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-[[1-(ethylamino)-1-oxopropan-2-yl]carbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | CCNC(=O)C(C)NC(=O)C1(C(=O)O)CCC1 |
| InChI | InChI=1S/C11H18N2O4/c1-3-12-8(14)7(2)13-9(15)11(10(16)17)5-4-6-11/h7H,3-6H2,1-2H3,(H,12,14)(H,13,15)(H,16,17) |
| InChIKey | LYASZATWOTWGLJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|