About [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine
[2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine (PubChem CID 55035254) has the molecular formula C13H15N3S
and a molecular weight of 245.35 g/mol. Its IUPAC name is [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine |
| PubChem CID | 55035254 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine |
| SMILES | CN1CCc2cc(-c3ncc(CN)s3)ccc21 |
| InChI | InChI=1S/C13H15N3S/c1-16-5-4-9-6-10(2-3-12(9)16)13-15-8-11(7-14)17-13/h2-3,6,8H,4-5,7,14H2,1H3 |
| InChIKey | HCNCJGHCMWZUPO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine?
The IUPAC name of [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine (CID 55035254) is [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine.
What is the SMILES notation for [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine?
The canonical SMILES for [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine is CN1CCc2cc(-c3ncc(CN)s3)ccc21.
What is the InChIKey of [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine?
The InChIKey is HCNCJGHCMWZUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3S/c1-16-5-4-9-6-10(2-3-12(9)16)13-15-8-11(7-14)17-13/h2-3,6,8H,4-5,7,14H2,1H3.
What are the key properties of [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine?
[2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine has a molecular weight of 245.35 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazol-5-yl]methanamine is sourced from PubChem (CID 55035254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).