About 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate
2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate (PubChem CID 55035785) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate.
Molecular Properties
| Compound Name | 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate |
| PubChem CID | 55035785 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate |
| SMILES | Nc1ccn(CC(=O)OCCc2ccccn2)n1 |
| InChI | InChI=1S/C12H14N4O2/c13-11-4-7-16(15-11)9-12(17)18-8-5-10-3-1-2-6-14-10/h1-4,6-7H,5,8-9H2,(H2,13,15) |
| InChIKey | WADFMNOGRXIMLN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate?
The IUPAC name of 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate (CID 55035785) is 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate.
What is the SMILES notation for 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate?
The canonical SMILES for 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate is Nc1ccn(CC(=O)OCCc2ccccn2)n1.
What is the InChIKey of 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate?
The InChIKey is WADFMNOGRXIMLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c13-11-4-7-16(15-11)9-12(17)18-8-5-10-3-1-2-6-14-10/h1-4,6-7H,5,8-9H2,(H2,13,15).
What are the key properties of 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate?
2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate has a molecular weight of 246.27 g/mol, XLogP of 0.65, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylethyl 2-(3-aminopyrazol-1-yl)acetate is sourced from PubChem (CID 55035785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).