C12H22F3NO — CID 55036534
[4-propyl-1-(2,2,2-trifluoroethoxy)cyclohexyl]methanamine (PubChem CID 55036534) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is [4-propyl-1-(2,2,2-trifluoroethoxy)cyclohexyl]methanamine.
| Compound Name | [4-propyl-1-(2,2,2-trifluoroethoxy)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 55036534 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | [4-propyl-1-(2,2,2-trifluoroethoxy)cyclohexyl]methanamine |
| SMILES | CCCC1CCC(CN)(OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3NO/c1-2-3-10-4-6-11(8-16,7-5-10)17-9-12(13,14)15/h10H,2-9,16H2,1H3 |
| InChIKey | WIIYBNVCBXAKBS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |