About zinc bis(2-tert-butyl-1,1-dimethylcyclopropane)
zinc bis(2-tert-butyl-1,1-dimethylcyclopropane) (PubChem CID 550367) has the molecular formula C18H34Zn
and a molecular weight of 315.86 g/mol. Its IUPAC name is zinc bis(2-tert-butyl-1,1-dimethylcyclopropane).
Molecular Properties
| Compound Name | zinc bis(2-tert-butyl-1,1-dimethylcyclopropane) |
| PubChem CID | 550367 |
| Molecular Formula | C18H34Zn |
| Molecular Weight | 315.86 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | zinc bis(2-tert-butyl-1,1-dimethylcyclopropane) |
| SMILES | CC(C)(C)C1[CH-]C1(C)C.CC(C)(C)C1[CH-]C1(C)C.[Zn+2] |
| InChI | InChI=1S/2C9H17.Zn/c2*1-8(2,3)7-6-9(7,4)5;/h2*6-7H,1-5H3;/q2*-1;+2 |
| InChIKey | CITJJIINVIFBKB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.86 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(2-tert-butyl-1,1-dimethylcyclopropane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(2-tert-butyl-1,1-dimethylcyclopropane)?
The IUPAC name of zinc bis(2-tert-butyl-1,1-dimethylcyclopropane) (CID 550367) is zinc bis(2-tert-butyl-1,1-dimethylcyclopropane).
What is the SMILES notation for zinc bis(2-tert-butyl-1,1-dimethylcyclopropane)?
The canonical SMILES for zinc bis(2-tert-butyl-1,1-dimethylcyclopropane) is CC(C)(C)C1[CH-]C1(C)C.CC(C)(C)C1[CH-]C1(C)C.[Zn+2].
What is the InChIKey of zinc bis(2-tert-butyl-1,1-dimethylcyclopropane)?
The InChIKey is CITJJIINVIFBKB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H17.Zn/c2*1-8(2,3)7-6-9(7,4)5;/h2*6-7H,1-5H3;/q2*-1;+2.
What are the key properties of zinc bis(2-tert-butyl-1,1-dimethylcyclopropane)?
zinc bis(2-tert-butyl-1,1-dimethylcyclopropane) has a molecular weight of 315.86 g/mol, XLogP of 5.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(2-tert-butyl-1,1-dimethylcyclopropane) is sourced from PubChem (CID 550367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).