C12H17N5O2 — CID 55037209
2-[4-(dimethylamino)butan-2-ylamino]-5-nitropyridine-3-carbonitrile (PubChem CID 55037209) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-[4-(dimethylamino)butan-2-ylamino]-5-nitropyridine-3-carbonitrile.
| Compound Name | 2-[4-(dimethylamino)butan-2-ylamino]-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 55037209 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-[4-(dimethylamino)butan-2-ylamino]-5-nitropyridine-3-carbonitrile |
| SMILES | CC(CCN(C)C)Nc1ncc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C12H17N5O2/c1-9(4-5-16(2)3)15-12-10(7-13)6-11(8-14-12)17(18)19/h6,8-9H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | QTDWZZKNYVKKJP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|