About 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide
4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide (PubChem CID 55037235) has the molecular formula C13H14N2O2S
and a molecular weight of 262.33 g/mol. Its IUPAC name is 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide.
Molecular Properties
| Compound Name | 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide |
| PubChem CID | 55037235 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide |
| SMILES | Cc1ccc(C(N)=S)cc1N1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C13H14N2O2S/c1-7-3-4-9(12(14)18)6-10(7)15-11(16)5-8(2)13(15)17/h3-4,6,8H,5H2,1-2H3,(H2,14,18) |
| InChIKey | ZJZRUKJPSQEAMJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide?
The IUPAC name of 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide (CID 55037235) is 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide.
What is the SMILES notation for 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide?
The canonical SMILES for 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide is Cc1ccc(C(N)=S)cc1N1C(=O)CC(C)C1=O.
What is the InChIKey of 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide?
The InChIKey is ZJZRUKJPSQEAMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2S/c1-7-3-4-9(12(14)18)6-10(7)15-11(16)5-8(2)13(15)17/h3-4,6,8H,5H2,1-2H3,(H2,14,18).
What are the key properties of 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide?
4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide has a molecular weight of 262.33 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide is sourced from PubChem (CID 55037235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).