C11H13F2N5 — CID 55037691
2,6-difluoro-1-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzene-1,4-diamine (PubChem CID 55037691) has the molecular formula C11H13F2N5 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2,6-difluoro-1-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzene-1,4-diamine.
| Compound Name | 2,6-difluoro-1-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 55037691 |
| Molecular Formula | C11H13F2N5 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2,6-difluoro-1-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzene-1,4-diamine |
| SMILES | CC(Nc1c(F)cc(N)cc1F)c1nncn1C |
| InChI | InChI=1S/C11H13F2N5/c1-6(11-17-15-5-18(11)2)16-10-8(12)3-7(14)4-9(10)13/h3-6,16H,14H2,1-2H3 |
| InChIKey | AVOUTKITZNWYGQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|