C14H18N2OS2 — CID 55037722
1-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)cyclopentane-1-carbothioamide (PubChem CID 55037722) has the molecular formula C14H18N2OS2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)cyclopentane-1-carbothioamide.
| Compound Name | 1-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 55037722 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)cyclopentane-1-carbothioamide |
| SMILES | NC(=S)C1(C(=O)N2CCc3sccc3C2)CCCC1 |
| InChI | InChI=1S/C14H18N2OS2/c15-12(18)14(5-1-2-6-14)13(17)16-7-3-11-10(9-16)4-8-19-11/h4,8H,1-3,5-7,9H2,(H2,15,18) |
| InChIKey | QYCGMZNQHSERCJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|