About N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide
N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide (PubChem CID 55037972) has the molecular formula C10H20N6O2S
and a molecular weight of 288.38 g/mol. Its IUPAC name is N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide.
Molecular Properties
| Compound Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide |
| PubChem CID | 55037972 |
| Molecular Formula | C10H20N6O2S |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide |
| SMILES | Cn1cnnc1CNS(=O)(=O)CCN1CCNCC1 |
| InChI | InChI=1S/C10H20N6O2S/c1-15-9-12-14-10(15)8-13-19(17,18)7-6-16-4-2-11-3-5-16/h9,11,13H,2-8H2,1H3 |
| InChIKey | BRRXROAFFWUVEH-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide?
The IUPAC name of N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide (CID 55037972) is N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide.
What is the SMILES notation for N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide?
The canonical SMILES for N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide is Cn1cnnc1CNS(=O)(=O)CCN1CCNCC1.
What is the InChIKey of N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide?
The InChIKey is BRRXROAFFWUVEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N6O2S/c1-15-9-12-14-10(15)8-13-19(17,18)7-6-16-4-2-11-3-5-16/h9,11,13H,2-8H2,1H3.
What are the key properties of N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide?
N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide has a molecular weight of 288.38 g/mol, XLogP of -1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-piperazin-1-ylethanesulfonamide is sourced from PubChem (CID 55037972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).