About 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid
4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid (PubChem CID 55038033) has the molecular formula C13H13BrN2O2
and a molecular weight of 309.16 g/mol. Its IUPAC name is 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid |
| PubChem CID | 55038033 |
| Molecular Formula | C13H13BrN2O2 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid |
| SMILES | Cc1ccc(C)c(-n2nc(C(=O)O)c(Br)c2C)c1 |
| InChI | InChI=1S/C13H13BrN2O2/c1-7-4-5-8(2)10(6-7)16-9(3)11(14)12(15-16)13(17)18/h4-6H,1-3H3,(H,17,18) |
| InChIKey | BVVCBLZIBJFTPP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid?
The IUPAC name of 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid (CID 55038033) is 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid.
What is the SMILES notation for 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid?
The canonical SMILES for 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid is Cc1ccc(C)c(-n2nc(C(=O)O)c(Br)c2C)c1.
What is the InChIKey of 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid?
The InChIKey is BVVCBLZIBJFTPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrN2O2/c1-7-4-5-8(2)10(6-7)16-9(3)11(14)12(15-16)13(17)18/h4-6H,1-3H3,(H,17,18).
What are the key properties of 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid?
4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid has a molecular weight of 309.16 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(2,5-dimethylphenyl)-5-methylpyrazole-3-carboxylic acid is sourced from PubChem (CID 55038033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).