C13H14N6 — CID 55038290
5-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinoline-5,8-diamine (PubChem CID 55038290) has the molecular formula C13H14N6 and a molecular weight of 254.30 g/mol. Its IUPAC name is 5-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinoline-5,8-diamine.
| Compound Name | 5-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 55038290 |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 5-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinoline-5,8-diamine |
| SMILES | Cn1cnnc1CNc1ccc(N)c2cnccc12 |
| InChI | InChI=1S/C13H14N6/c1-19-8-17-18-13(19)7-16-12-3-2-11(14)10-6-15-5-4-9(10)12/h2-6,8,16H,7,14H2,1H3 |
| InChIKey | WOFRGFDADGLQSA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|