About 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane
5,6-dimethyl-2-propan-2-yl-1,3-oxathiane (PubChem CID 550383) has the molecular formula C9H18OS
and a molecular weight of 174.31 g/mol. Its IUPAC name is 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane.
Molecular Properties
| Compound Name | 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane |
| PubChem CID | 550383 |
| Molecular Formula | C9H18OS |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane |
| SMILES | CC(C)C1OC(C)C(C)CS1 |
| InChI | InChI=1S/C9H18OS/c1-6(2)9-10-8(4)7(3)5-11-9/h6-9H,5H2,1-4H3 |
| InChIKey | BXMUWCMLCXZSJT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane?
The IUPAC name of 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane (CID 550383) is 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane.
What is the SMILES notation for 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane?
The canonical SMILES for 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane is CC(C)C1OC(C)C(C)CS1.
What is the InChIKey of 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane?
The InChIKey is BXMUWCMLCXZSJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18OS/c1-6(2)9-10-8(4)7(3)5-11-9/h6-9H,5H2,1-4H3.
What are the key properties of 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane?
5,6-dimethyl-2-propan-2-yl-1,3-oxathiane has a molecular weight of 174.31 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-2-propan-2-yl-1,3-oxathiane is sourced from PubChem (CID 550383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).